C13H14N2O4S — CID 8849192
cyanomethyl (2S)-2-[[(E)-2-phenylethenyl]sulfonylamino]propanoate (PubChem CID 8849192) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is cyanomethyl (2S)-2-[[(E)-2-phenylethenyl]sulfonylamino]propanoate.
| Compound Name | cyanomethyl (2S)-2-[[(E)-2-phenylethenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8849192 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | cyanomethyl (2S)-2-[[(E)-2-phenylethenyl]sulfonylamino]propanoate |
| SMILES | C[C@H](NS(=O)(=O)/C=C/c1ccccc1)C(=O)OCC#N |
| InChI | InChI=1S/C13H14N2O4S/c1-11(13(16)19-9-8-14)15-20(17,18)10-7-12-5-3-2-4-6-12/h2-7,10-11,15H,9H2,1H3/b10-7+/t11-/m0/s1 |
| InChIKey | NUCKHYYYVHRUDA-HUYFXPKMSA-N |
| XLogP | 1.03 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |