C19H30N2O3S2 — CID 43060632
N-(4-methylpentyl)-4-methylsulfanyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide (PubChem CID 43060632) has the molecular formula C19H30N2O3S2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N-(4-methylpentyl)-4-methylsulfanyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide.
| Compound Name | N-(4-methylpentyl)-4-methylsulfanyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide |
|---|---|
| PubChem CID | 43060632 |
| Molecular Formula | C19H30N2O3S2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-(4-methylpentyl)-4-methylsulfanyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide |
| SMILES | CSCCC(NS(=O)(=O)/C=C/c1ccccc1)C(=O)NCCCC(C)C |
| InChI | InChI=1S/C19H30N2O3S2/c1-16(2)8-7-13-20-19(22)18(11-14-25-3)21-26(23,24)15-12-17-9-5-4-6-10-17/h4-6,9-10,12,15-16,18,21H,7-8,11,13-14H2,1-3H3,(H,20,22)/b15-12+ |
| InChIKey | IIYCEPGQISQRMS-NTCAYCPXSA-N |
| XLogP | 3.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|