C20H30N2O5S2 — CID 43004185
methyl 6-[[4-methylsulfanyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanoyl]amino]hexanoate (PubChem CID 43004185) has the molecular formula C20H30N2O5S2 and a molecular weight of 442.60 g/mol. Its IUPAC name is methyl 6-[[4-methylsulfanyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanoyl]amino]hexanoate.
| Compound Name | methyl 6-[[4-methylsulfanyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 43004185 |
| Molecular Formula | C20H30N2O5S2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | methyl 6-[[4-methylsulfanyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)C(CCSC)NS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H30N2O5S2/c1-27-19(23)11-7-4-8-14-21-20(24)18(12-15-28-2)22-29(25,26)16-13-17-9-5-3-6-10-17/h3,5-6,9-10,13,16,18,22H,4,7-8,11-12,14-15H2,1-2H3,(H,21,24)/b16-13+ |
| InChIKey | FBNVVGXHCHMQCV-DTQAZKPQSA-N |
| XLogP | 2.55 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|