C18H17NO4S2 — CID 117054904
(E)-N-[2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]-2-phenylethenesulfonamide (PubChem CID 117054904) has the molecular formula C18H17NO4S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (E)-N-[2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 117054904 |
| Molecular Formula | C18H17NO4S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (E)-N-[2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]-2-phenylethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)NCC(O)(c1ccco1)c1cccs1 |
| InChI | InChI=1S/C18H17NO4S2/c20-18(16-8-4-11-23-16,17-9-5-12-24-17)14-19-25(21,22)13-10-15-6-2-1-3-7-15/h1-13,19-20H,14H2/b13-10+ |
| InChIKey | NGQQZXMONUPOSE-JLHYYAGUSA-N |
| XLogP | 3.17 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |