C17H21NO3S2 — CID 91816644
2-cyclopentylsulfanyl-N-[2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]acetamide (PubChem CID 91816644) has the molecular formula C17H21NO3S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-[2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-cyclopentylsulfanyl-N-[2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 91816644 |
| Molecular Formula | C17H21NO3S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-[2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]acetamide |
| SMILES | O=C(CSC1CCCC1)NCC(O)(c1ccco1)c1cccs1 |
| InChI | InChI=1S/C17H21NO3S2/c19-16(11-23-13-5-1-2-6-13)18-12-17(20,14-7-3-9-21-14)15-8-4-10-22-15/h3-4,7-10,13,20H,1-2,5-6,11-12H2,(H,18,19) |
| InChIKey | FTJQFCIOURPXJD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |