C19H17NO3S — CID 100687563
(E)-N-[(2R)-2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]-3-phenylprop-2-enamide (PubChem CID 100687563) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is (E)-N-[(2R)-2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2R)-2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 100687563 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (E)-N-[(2R)-2-(furan-2-yl)-2-hydroxy-2-thiophen-2-ylethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC[C@@](O)(c1ccco1)c1cccs1 |
| InChI | InChI=1S/C19H17NO3S/c21-18(11-10-15-6-2-1-3-7-15)20-14-19(22,16-8-4-12-23-16)17-9-5-13-24-17/h1-13,22H,14H2,(H,20,21)/b11-10+/t19-/m1/s1 |
| InChIKey | NYMACQRDSOTDIL-GNISGLHKSA-N |
| XLogP | 3.41 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|