C15H22F3NO3S — CID 17154344
N-(6-methylheptan-2-yl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 17154344) has the molecular formula C15H22F3NO3S and a molecular weight of 353.41 g/mol. Its IUPAC name is N-(6-methylheptan-2-yl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(6-methylheptan-2-yl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 17154344 |
| Molecular Formula | C15H22F3NO3S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-(6-methylheptan-2-yl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CC(C)CCCC(C)NS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H22F3NO3S/c1-11(2)5-4-6-12(3)19-23(20,21)14-9-7-13(8-10-14)22-15(16,17)18/h7-12,19H,4-6H2,1-3H3 |
| InChIKey | JCGXAUBNFFFYQR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |