C33H36N6O6S — CID 59074032
(2S)-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]-3-[4-[(4-phenyl-2,3-dihydrothiadiazole-5-carbonyl)amino]phenyl]propanoic acid (PubChem CID 59074032) has the molecular formula C33H36N6O6S and a molecular weight of 644.75 g/mol. Its IUPAC name is (2S)-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]-3-[4-[(4-phenyl-2,3-dihydrothiadiazole-5-carbonyl)amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]-3-[4-[(4-phenyl-2,3-dihydrothiadiazole-5-carbonyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59074032 |
| Molecular Formula | C33H36N6O6S |
| Molecular Weight | 644.75 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | (2S)-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]-3-[4-[(4-phenyl-2,3-dihydrothiadiazole-5-carbonyl)amino]phenyl]propanoic acid |
| SMILES | COc1ccc(NNC(=O)C2CCC(C(=O)N[C@@H](Cc3ccc(NC(=O)C4=C(c5ccccc5)NNS4)cc3)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C33H36N6O6S/c1-45-26-17-15-25(16-18-26)36-38-31(41)23-11-9-22(10-12-23)30(40)35-27(33(43)44)19-20-7-13-24(14-8-20)34-32(42)29-28(37-39-46-29)21-5-3-2-4-6-21/h2-8,13-18,22-23,27,36-37,39H,9-12,19H2,1H3,(H,34,42)(H,35,40)(H,38,41)(H,43,44)/t22?,23?,27-/m0/s1 |
| InChIKey | YIMOBTRBMRFTOF-GMKWRKAISA-N |
| XLogP | 3.82 |
| TPSA | 169.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.75 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|