C20H19Cl2NO5 — CID 20758732
3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-methyl-3-oxopropanoyl)amino]propanoic acid (PubChem CID 20758732) has the molecular formula C20H19Cl2NO5 and a molecular weight of 424.28 g/mol. Its IUPAC name is 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-methyl-3-oxopropanoyl)amino]propanoic acid.
| Compound Name | 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-methyl-3-oxopropanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 20758732 |
| Molecular Formula | C20H19Cl2NO5 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-methyl-3-oxopropanoyl)amino]propanoic acid |
| SMILES | CC(C=O)C(=O)NC(Cc1ccc(OCc2c(Cl)cccc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C20H19Cl2NO5/c1-12(10-24)19(25)23-18(20(26)27)9-13-5-7-14(8-6-13)28-11-15-16(21)3-2-4-17(15)22/h2-8,10,12,18H,9,11H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | CAFWMDVBIGSWGB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|