C17H18N2O6S — CID 110291977
1-(2,5-dimethoxyphenyl)sulfonyl-7-nitro-3,4-dihydro-2H-quinoline (PubChem CID 110291977) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-7-nitro-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-7-nitro-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 110291977 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-7-nitro-3,4-dihydro-2H-quinoline |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCCc3ccc([N+](=O)[O-])cc32)c1 |
| InChI | InChI=1S/C17H18N2O6S/c1-24-14-7-8-16(25-2)17(11-14)26(22,23)18-9-3-4-12-5-6-13(19(20)21)10-15(12)18/h5-8,10-11H,3-4,9H2,1-2H3 |
| InChIKey | UOVVUNOWLXLVCO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|