C17H17FN2O — CID 154782506
N-benzyl-5-fluoro-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 154782506) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is N-benzyl-5-fluoro-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-benzyl-5-fluoro-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 154782506 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-benzyl-5-fluoro-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCCc2c(F)cccc21 |
| InChI | InChI=1S/C17H17FN2O/c18-15-9-4-10-16-14(15)8-5-11-20(16)17(21)19-12-13-6-2-1-3-7-13/h1-4,6-7,9-10H,5,8,11-12H2,(H,19,21) |
| InChIKey | WQYOMEHDPASHRZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |