C22H16F3N3O5S — CID 37163279
4-(6-nitro-2,3-dihydroindole-1-carbonyl)-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 37163279) has the molecular formula C22H16F3N3O5S and a molecular weight of 491.45 g/mol. Its IUPAC name is 4-(6-nitro-2,3-dihydroindole-1-carbonyl)-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-(6-nitro-2,3-dihydroindole-1-carbonyl)-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 37163279 |
| Molecular Formula | C22H16F3N3O5S |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 4-(6-nitro-2,3-dihydroindole-1-carbonyl)-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | O=C(c1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H16F3N3O5S/c23-22(24,25)16-2-1-3-17(12-16)26-34(32,33)19-8-5-15(6-9-19)21(29)27-11-10-14-4-7-18(28(30)31)13-20(14)27/h1-9,12-13,26H,10-11H2 |
| InChIKey | VVHIFOQSCWPHPT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|