C18H17N3O5S — CID 37161956
N-cyclopropyl-3-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide (PubChem CID 37161956) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is N-cyclopropyl-3-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide.
| Compound Name | N-cyclopropyl-3-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 37161956 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-cyclopropyl-3-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide |
| SMILES | O=C(c1cccc(S(=O)(=O)NC2CC2)c1)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H17N3O5S/c22-18(20-9-8-12-4-7-15(21(23)24)11-17(12)20)13-2-1-3-16(10-13)27(25,26)19-14-5-6-14/h1-4,7,10-11,14,19H,5-6,8-9H2 |
| InChIKey | DXAXGXYMFCCATN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|