C20H23N3O5S — CID 55483239
N,N-diethyl-2-methyl-5-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide (PubChem CID 55483239) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is N,N-diethyl-2-methyl-5-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide.
| Compound Name | N,N-diethyl-2-methyl-5-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55483239 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N,N-diethyl-2-methyl-5-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N2CCc3ccc([N+](=O)[O-])cc32)ccc1C |
| InChI | InChI=1S/C20H23N3O5S/c1-4-21(5-2)29(27,28)19-12-16(7-6-14(19)3)20(24)22-11-10-15-8-9-17(23(25)26)13-18(15)22/h6-9,12-13H,4-5,10-11H2,1-3H3 |
| InChIKey | RTCJECDPBKBPPC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|