C18H19N3O5S — CID 37161902
N,2,3-trimethyl-5-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide (PubChem CID 37161902) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is N,2,3-trimethyl-5-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide.
| Compound Name | N,2,3-trimethyl-5-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 37161902 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N,2,3-trimethyl-5-(6-nitro-2,3-dihydroindole-1-carbonyl)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N2CCc3ccc([N+](=O)[O-])cc32)cc(C)c1C |
| InChI | InChI=1S/C18H19N3O5S/c1-11-8-14(9-17(12(11)2)27(25,26)19-3)18(22)20-7-6-13-4-5-15(21(23)24)10-16(13)20/h4-5,8-10,19H,6-7H2,1-3H3 |
| InChIKey | KNVRCPDCZYTBMU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|