C17H18N8O3S — CID 55450071
2-[[4-amino-5-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 55450071) has the molecular formula C17H18N8O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-[[4-amino-5-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-[[4-amino-5-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 55450071 |
| Molecular Formula | C17H18N8O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[[4-amino-5-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | Cc1cc(C)n(-c2nnc(SCC(=O)N3CCc4cc([N+](=O)[O-])ccc43)n2N)n1 |
| InChI | InChI=1S/C17H18N8O3S/c1-10-7-11(2)24(21-10)16-19-20-17(23(16)18)29-9-15(26)22-6-5-12-8-13(25(27)28)3-4-14(12)22/h3-4,7-8H,5-6,9,18H2,1-2H3 |
| InChIKey | RGOUSBFIDZFTNA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|