C21H20N4O3S — CID 27190839
2-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 27190839) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 27190839 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | Cc1cccc(-n2ccnc2SCC(=O)N2CCc3cc([N+](=O)[O-])ccc32)c1C |
| InChI | InChI=1S/C21H20N4O3S/c1-14-4-3-5-18(15(14)2)24-11-9-22-21(24)29-13-20(26)23-10-8-16-12-17(25(27)28)6-7-19(16)23/h3-7,9,11-12H,8,10,13H2,1-2H3 |
| InChIKey | HRVKITISTUSIJY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|