C19H19N4OS+ — CID 3291619
1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]ethanone (PubChem CID 3291619) has the molecular formula C19H19N4OS+ and a molecular weight of 351.46 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]ethanone.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 3291619 |
| Molecular Formula | C19H19N4OS+ |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]ethanone |
| SMILES | O=C(CSc1nc[nH][n+]1-c1ccccc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H18N4OS/c24-18(22-12-6-8-15-7-4-5-11-17(15)22)13-25-19-20-14-21-23(19)16-9-2-1-3-10-16/h1-5,7,9-11,14H,6,8,12-13H2/p+1 |
| InChIKey | OVUNIYLKASVGNM-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|