C24H25N2O+ — CID 8595991
benzhydryl-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]azanium (PubChem CID 8595991) has the molecular formula C24H25N2O+ and a molecular weight of 357.48 g/mol. Its IUPAC name is benzhydryl-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]azanium.
| Compound Name | benzhydryl-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8595991 |
| Molecular Formula | C24H25N2O+ |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | benzhydryl-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]azanium |
| SMILES | O=C(C[NH2+]C(c1ccccc1)c1ccccc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C24H24N2O/c27-23(26-17-9-15-19-10-7-8-16-22(19)26)18-25-24(20-11-3-1-4-12-20)21-13-5-2-6-14-21/h1-8,10-14,16,24-25H,9,15,17-18H2/p+1 |
| InChIKey | KHQZZUIMFGYJMJ-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |