C19H21N5OS — CID 60519630
1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethanone (PubChem CID 60519630) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethanone.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 60519630 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethanone |
| SMILES | Cc1nc2nc(SCC(=O)N3CCCc4ccccc43)nn2c(C)c1C |
| InChI | InChI=1S/C19H21N5OS/c1-12-13(2)20-18-21-19(22-24(18)14(12)3)26-11-17(25)23-10-6-8-15-7-4-5-9-16(15)23/h4-5,7,9H,6,8,10-11H2,1-3H3 |
| InChIKey | JCQYEHRDNHECGW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |