C22H27BrN2O2S — CID 4959757
3-bromo-4-hexoxy-N-(1-phenylethylcarbamothioyl)benzamide (PubChem CID 4959757) has the molecular formula C22H27BrN2O2S and a molecular weight of 463.44 g/mol. Its IUPAC name is 3-bromo-4-hexoxy-N-(1-phenylethylcarbamothioyl)benzamide.
| Compound Name | 3-bromo-4-hexoxy-N-(1-phenylethylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 4959757 |
| Molecular Formula | C22H27BrN2O2S |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 3-bromo-4-hexoxy-N-(1-phenylethylcarbamothioyl)benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)NC(C)c2ccccc2)cc1Br |
| InChI | InChI=1S/C22H27BrN2O2S/c1-3-4-5-9-14-27-20-13-12-18(15-19(20)23)21(26)25-22(28)24-16(2)17-10-7-6-8-11-17/h6-8,10-13,15-16H,3-5,9,14H2,1-2H3,(H2,24,25,26,28) |
| InChIKey | GZOMPXVEYJQZOK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|