C12H15BrN2O2S — CID 4956263
3-bromo-4-butoxy-N-carbamothioylbenzamide (PubChem CID 4956263) has the molecular formula C12H15BrN2O2S and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-carbamothioylbenzamide.
| Compound Name | 3-bromo-4-butoxy-N-carbamothioylbenzamide |
|---|---|
| PubChem CID | 4956263 |
| Molecular Formula | C12H15BrN2O2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 3-bromo-4-butoxy-N-carbamothioylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(N)=S)cc1Br |
| InChI | InChI=1S/C12H15BrN2O2S/c1-2-3-6-17-10-5-4-8(7-9(10)13)11(16)15-12(14)18/h4-5,7H,2-3,6H2,1H3,(H3,14,15,16,18) |
| InChIKey | HXJCOKGWDOBUKH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|