C13H17BrN2O4 — CID 4955902
methyl N-[(3-bromo-4-butoxybenzoyl)amino]carbamate (PubChem CID 4955902) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is methyl N-[(3-bromo-4-butoxybenzoyl)amino]carbamate.
| Compound Name | methyl N-[(3-bromo-4-butoxybenzoyl)amino]carbamate |
|---|---|
| PubChem CID | 4955902 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | methyl N-[(3-bromo-4-butoxybenzoyl)amino]carbamate |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)OC)cc1Br |
| InChI | InChI=1S/C13H17BrN2O4/c1-3-4-7-20-11-6-5-9(8-10(11)14)12(17)15-16-13(18)19-2/h5-6,8H,3-4,7H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | HHFGPDIKHHJMSO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|