C24H22N2O3 — CID 109057107
3-(2,3-dihydroindole-1-carbonyl)-N-(2-methoxy-5-methylphenyl)benzamide (PubChem CID 109057107) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-(2,3-dihydroindole-1-carbonyl)-N-(2-methoxy-5-methylphenyl)benzamide.
| Compound Name | 3-(2,3-dihydroindole-1-carbonyl)-N-(2-methoxy-5-methylphenyl)benzamide |
|---|---|
| PubChem CID | 109057107 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-(2,3-dihydroindole-1-carbonyl)-N-(2-methoxy-5-methylphenyl)benzamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1cccc(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C24H22N2O3/c1-16-10-11-22(29-2)20(14-16)25-23(27)18-7-5-8-19(15-18)24(28)26-13-12-17-6-3-4-9-21(17)26/h3-11,14-15H,12-13H2,1-2H3,(H,25,27) |
| InChIKey | ANTYUWJSWXGLSA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |