C20H16N2O3 — CID 34818899
N-[4-(2,3-dihydroindole-1-carbonyl)phenyl]furan-2-carboxamide (PubChem CID 34818899) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[4-(2,3-dihydroindole-1-carbonyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(2,3-dihydroindole-1-carbonyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34818899 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[4-(2,3-dihydroindole-1-carbonyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCc3ccccc32)cc1)c1ccco1 |
| InChI | InChI=1S/C20H16N2O3/c23-19(18-6-3-13-25-18)21-16-9-7-15(8-10-16)20(24)22-12-11-14-4-1-2-5-17(14)22/h1-10,13H,11-12H2,(H,21,23) |
| InChIKey | YKIPSWYIZYVCQQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |