C19H21ClN4O2 — CID 109104479
N-(3-chloro-2-methylphenyl)-5-(4-methylpiperazine-1-carbonyl)pyridine-3-carboxamide (PubChem CID 109104479) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-5-(4-methylpiperazine-1-carbonyl)pyridine-3-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-5-(4-methylpiperazine-1-carbonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109104479 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-5-(4-methylpiperazine-1-carbonyl)pyridine-3-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1cncc(C(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C19H21ClN4O2/c1-13-16(20)4-3-5-17(13)22-18(25)14-10-15(12-21-11-14)19(26)24-8-6-23(2)7-9-24/h3-5,10-12H,6-9H2,1-2H3,(H,22,25) |
| InChIKey | KWCAYWIXXSSJGV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |