C18H18ClN3O4S — CID 92683589
N-[2-chloro-4-(4-formylpiperazine-1-carbonyl)phenyl]benzenesulfonamide (PubChem CID 92683589) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is N-[2-chloro-4-(4-formylpiperazine-1-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-chloro-4-(4-formylpiperazine-1-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 92683589 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[2-chloro-4-(4-formylpiperazine-1-carbonyl)phenyl]benzenesulfonamide |
| SMILES | O=CN1CCN(C(=O)c2ccc(NS(=O)(=O)c3ccccc3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H18ClN3O4S/c19-16-12-14(18(24)22-10-8-21(13-23)9-11-22)6-7-17(16)20-27(25,26)15-4-2-1-3-5-15/h1-7,12-13,20H,8-11H2 |
| InChIKey | HNTVDECILXDEBJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|