C30H33N3O3 — CID 150262037
9-[4-[4-(phenylcarbamoyl)-1,4-diazepan-1-yl]butyl]fluorene-9-carboxylic acid (PubChem CID 150262037) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 9-[4-[4-(phenylcarbamoyl)-1,4-diazepan-1-yl]butyl]fluorene-9-carboxylic acid.
| Compound Name | 9-[4-[4-(phenylcarbamoyl)-1,4-diazepan-1-yl]butyl]fluorene-9-carboxylic acid |
|---|---|
| PubChem CID | 150262037 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 9-[4-[4-(phenylcarbamoyl)-1,4-diazepan-1-yl]butyl]fluorene-9-carboxylic acid |
| SMILES | O=C(Nc1ccccc1)N1CCCN(CCCCC2(C(=O)O)c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C30H33N3O3/c34-28(35)30(26-15-6-4-13-24(26)25-14-5-7-16-27(25)30)17-8-9-18-32-19-10-20-33(22-21-32)29(36)31-23-11-2-1-3-12-23/h1-7,11-16H,8-10,17-22H2,(H,31,36)(H,34,35) |
| InChIKey | GBTIPSASPPDDPZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|