C30H31ClN2O3 — CID 141040006
9-[4-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid (PubChem CID 141040006) has the molecular formula C30H31ClN2O3 and a molecular weight of 503.04 g/mol. Its IUPAC name is 9-[4-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid.
| Compound Name | 9-[4-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid |
|---|---|
| PubChem CID | 141040006 |
| Molecular Formula | C30H31ClN2O3 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 9-[4-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid |
| SMILES | O=C(Cc1cccc(Cl)c1)N1CCN(CCCCC2(C(=O)O)c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C30H31ClN2O3/c31-23-9-7-8-22(20-23)21-28(34)33-18-16-32(17-19-33)15-6-5-14-30(29(35)36)26-12-3-1-10-24(26)25-11-2-4-13-27(25)30/h1-4,7-13,20H,5-6,14-19,21H2,(H,35,36) |
| InChIKey | YEKLSAQVOBOCKL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|