C30H38N2O3 — CID 174461621
9-[4-[4-(2-cyclohexylacetyl)piperazin-1-yl]butyl]fluorene-9-carboxylic acid (PubChem CID 174461621) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is 9-[4-[4-(2-cyclohexylacetyl)piperazin-1-yl]butyl]fluorene-9-carboxylic acid.
| Compound Name | 9-[4-[4-(2-cyclohexylacetyl)piperazin-1-yl]butyl]fluorene-9-carboxylic acid |
|---|---|
| PubChem CID | 174461621 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 9-[4-[4-(2-cyclohexylacetyl)piperazin-1-yl]butyl]fluorene-9-carboxylic acid |
| SMILES | O=C(CC1CCCCC1)N1CCN(CCCCC2(C(=O)O)c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C30H38N2O3/c33-28(22-23-10-2-1-3-11-23)32-20-18-31(19-21-32)17-9-8-16-30(29(34)35)26-14-6-4-12-24(26)25-13-5-7-15-27(25)30/h4-7,12-15,23H,1-3,8-11,16-22H2,(H,34,35) |
| InChIKey | SUQZCZCWAIIMQJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|