C33H48N3O2P3 — CID 163532707
9-[4-[4-[(2-cyclohexylacetyl)amino]piperidin-1-yl]butyl]-N-[2,2,2-tris(phosphanyl)ethyl]fluorene-9-carboxamide (PubChem CID 163532707) has the molecular formula C33H48N3O2P3 and a molecular weight of 611.69 g/mol. Its IUPAC name is 9-[4-[4-[(2-cyclohexylacetyl)amino]piperidin-1-yl]butyl]-N-[2,2,2-tris(phosphanyl)ethyl]fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[(2-cyclohexylacetyl)amino]piperidin-1-yl]butyl]-N-[2,2,2-tris(phosphanyl)ethyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 163532707 |
| Molecular Formula | C33H48N3O2P3 |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | 9-[4-[4-[(2-cyclohexylacetyl)amino]piperidin-1-yl]butyl]-N-[2,2,2-tris(phosphanyl)ethyl]fluorene-9-carboxamide |
| SMILES | O=C(CC1CCCCC1)NC1CCN(CCCCC2(C(=O)NCC(P)(P)P)c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C33H48N3O2P3/c37-30(22-24-10-2-1-3-11-24)35-25-16-20-36(21-17-25)19-9-8-18-32(31(38)34-23-33(39,40)41)28-14-6-4-12-26(28)27-13-5-7-15-29(27)32/h4-7,12-15,24-25H,1-3,8-11,16-23,39-41H2,(H,34,38)(H,35,37) |
| InChIKey | DUIWUQQLLUJAKY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|