C35H40N3O3P3 — CID 148726888
4-phenyl-N-[3-[4-[9-[2,2,2-tris(phosphanyl)ethylcarbamoyl]fluoren-9-yl]butyl]cyclopentyl]-1,3-oxazole-5-carboxamide (PubChem CID 148726888) has the molecular formula C35H40N3O3P3 and a molecular weight of 643.65 g/mol. Its IUPAC name is 4-phenyl-N-[3-[4-[9-[2,2,2-tris(phosphanyl)ethylcarbamoyl]fluoren-9-yl]butyl]cyclopentyl]-1,3-oxazole-5-carboxamide.
| Compound Name | 4-phenyl-N-[3-[4-[9-[2,2,2-tris(phosphanyl)ethylcarbamoyl]fluoren-9-yl]butyl]cyclopentyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 148726888 |
| Molecular Formula | C35H40N3O3P3 |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | 4-phenyl-N-[3-[4-[9-[2,2,2-tris(phosphanyl)ethylcarbamoyl]fluoren-9-yl]butyl]cyclopentyl]-1,3-oxazole-5-carboxamide |
| SMILES | O=C(NC1CCC(CCCCC2(C(=O)NCC(P)(P)P)c3ccccc3-c3ccccc32)C1)c1ocnc1-c1ccccc1 |
| InChI | InChI=1S/C35H40N3O3P3/c39-32(31-30(37-22-41-31)24-11-2-1-3-12-24)38-25-18-17-23(20-25)10-8-9-19-34(33(40)36-21-35(42,43)44)28-15-6-4-13-26(28)27-14-5-7-16-29(27)34/h1-7,11-16,22-23,25H,8-10,17-21,42-44H2,(H,36,40)(H,38,39) |
| InChIKey | OAENNIFBGQWFET-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|