C39H37F6N3O3 — CID 122392074
9-[4-[1-oxido-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-ium-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 122392074) has the molecular formula C39H37F6N3O3 and a molecular weight of 709.73 g/mol. Its IUPAC name is 9-[4-[1-oxido-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-ium-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[1-oxido-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-ium-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 122392074 |
| Molecular Formula | C39H37F6N3O3 |
| Molecular Weight | 709.73 g/mol |
| Exact Mass | 709.27 |
| IUPAC Name | 9-[4-[1-oxido-4-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-ium-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CC[N+]([O-])(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C39H37F6N3O3/c40-38(41,42)25-46-36(50)37(33-9-3-1-7-31(33)32-8-2-4-10-34(32)37)21-5-6-22-48(51)23-19-30(20-24-48)47-35(49)28-13-11-26(12-14-28)27-15-17-29(18-16-27)39(43,44)45/h1-4,7-18,30H,5-6,19-25H2,(H,46,50)(H,47,49) |
| InChIKey | WTGSRLIXVCAXES-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.73 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|