C37H33F6N3O3 — CID 22891473
N-(2,2,2-trifluoroethyl)-9-[4-[3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoylamino]butyl]fluorene-9-carboxamide (PubChem CID 22891473) has the molecular formula C37H33F6N3O3 and a molecular weight of 681.68 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-9-[4-[3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoylamino]butyl]fluorene-9-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-9-[4-[3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoylamino]butyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891473 |
| Molecular Formula | C37H33F6N3O3 |
| Molecular Weight | 681.68 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-9-[4-[3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoylamino]butyl]fluorene-9-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1)NCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H33F6N3O3/c38-36(39,40)23-46-34(49)35(30-13-5-3-10-27(30)28-11-4-6-14-31(28)35)20-7-8-21-44-32(47)19-22-45-33(48)29-12-2-1-9-26(29)24-15-17-25(18-16-24)37(41,42)43/h1-6,9-18H,7-8,19-23H2,(H,44,47)(H,45,48)(H,46,49) |
| InChIKey | LOKBPTZDNORJGY-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.68 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|