C42H41F5IN3O3 — CID 162576824
1-[2-[4-[difluoro-(methylidene-λ3-iodanyl)methyl]phenyl]benzoyl]-N-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentyl]piperidine-4-carboxamide (PubChem CID 162576824) has the molecular formula C42H41F5IN3O3 and a molecular weight of 857.70 g/mol. Its IUPAC name is 1-[2-[4-[difluoro-(methylidene-λ3-iodanyl)methyl]phenyl]benzoyl]-N-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[4-[difluoro-(methylidene-λ3-iodanyl)methyl]phenyl]benzoyl]-N-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162576824 |
| Molecular Formula | C42H41F5IN3O3 |
| Molecular Weight | 857.70 g/mol |
| Exact Mass | 857.21 |
| IUPAC Name | 1-[2-[4-[difluoro-(methylidene-λ3-iodanyl)methyl]phenyl]benzoyl]-N-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentyl]piperidine-4-carboxamide |
| SMILES | C=IC(F)(F)c1ccc(-c2ccccc2C(=O)N2CCC(C(=O)NCCCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C42H41F5IN3O3/c1-48-42(46,47)30-19-17-28(18-20-30)31-11-3-4-14-34(31)38(53)51-25-21-29(22-26-51)37(52)49-24-10-2-9-23-40(39(54)50-27-41(43,44)45)35-15-7-5-12-32(35)33-13-6-8-16-36(33)40/h3-8,11-20,29H,1-2,9-10,21-27H2,(H,49,52)(H,50,54) |
| InChIKey | FGLFHPIXRAVLAJ-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.70 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|