C38H39F3N4O2 — CID 54531955
9-[4-[4-[(2-anilinobenzoyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 54531955) has the molecular formula C38H39F3N4O2 and a molecular weight of 640.75 g/mol. Its IUPAC name is 9-[4-[4-[(2-anilinobenzoyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[(2-anilinobenzoyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 54531955 |
| Molecular Formula | C38H39F3N4O2 |
| Molecular Weight | 640.75 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | 9-[4-[4-[(2-anilinobenzoyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C38H39F3N4O2/c39-38(40,41)26-42-36(47)37(32-17-7-4-14-29(32)30-15-5-8-18-33(30)37)22-10-11-23-45-24-20-28(21-25-45)44-35(46)31-16-6-9-19-34(31)43-27-12-2-1-3-13-27/h1-9,12-19,28,43H,10-11,20-26H2,(H,42,47)(H,44,46) |
| InChIKey | YXEATNZWJVLLIA-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.75 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|