C33H37F6N3O2 — CID 162576642
N-(2,2,2-trifluoroethyl)-9-[4-[4-[[4-(trifluoromethyl)benzoyl]amino]piperidin-1-yl]butyl]-1,2,3,4-tetrahydrofluorene-9-carboxamide (PubChem CID 162576642) has the molecular formula C33H37F6N3O2 and a molecular weight of 621.67 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-9-[4-[4-[[4-(trifluoromethyl)benzoyl]amino]piperidin-1-yl]butyl]-1,2,3,4-tetrahydrofluorene-9-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-9-[4-[4-[[4-(trifluoromethyl)benzoyl]amino]piperidin-1-yl]butyl]-1,2,3,4-tetrahydrofluorene-9-carboxamide |
|---|---|
| PubChem CID | 162576642 |
| Molecular Formula | C33H37F6N3O2 |
| Molecular Weight | 621.67 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-9-[4-[4-[[4-(trifluoromethyl)benzoyl]amino]piperidin-1-yl]butyl]-1,2,3,4-tetrahydrofluorene-9-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)C3=C(CCCC3)c3ccccc32)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H37F6N3O2/c34-32(35,36)21-40-30(44)31(27-9-3-1-7-25(27)26-8-2-4-10-28(26)31)17-5-6-18-42-19-15-24(16-20-42)41-29(43)22-11-13-23(14-12-22)33(37,38)39/h1,3,7,9,11-14,24H,2,4-6,8,10,15-21H2,(H,40,44)(H,41,43) |
| InChIKey | QHDRHZFBSWHNOQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.67 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|