C37H35F6N3O — CID 22640147
N-(2,2,2-trifluoroethyl)-9-[4-[4-[3-[4-(trifluoromethyl)phenyl]phenyl]piperazin-1-yl]butyl]fluorene-9-carboxamide (PubChem CID 22640147) has the molecular formula C37H35F6N3O and a molecular weight of 651.70 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-9-[4-[4-[3-[4-(trifluoromethyl)phenyl]phenyl]piperazin-1-yl]butyl]fluorene-9-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-9-[4-[4-[3-[4-(trifluoromethyl)phenyl]phenyl]piperazin-1-yl]butyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22640147 |
| Molecular Formula | C37H35F6N3O |
| Molecular Weight | 651.70 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-9-[4-[4-[3-[4-(trifluoromethyl)phenyl]phenyl]piperazin-1-yl]butyl]fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCN2CCN(c3cccc(-c4ccc(C(F)(F)F)cc4)c3)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H35F6N3O/c38-36(39,40)25-44-34(47)35(32-12-3-1-10-30(32)31-11-2-4-13-33(31)35)18-5-6-19-45-20-22-46(23-21-45)29-9-7-8-27(24-29)26-14-16-28(17-15-26)37(41,42)43/h1-4,7-17,24H,5-6,18-23,25H2,(H,44,47) |
| InChIKey | QNBGSBKOLDBEAW-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.70 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|