C30H34ClF3N4O — CID 22640107
9-[4-[4-(4-aminophenyl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;hydrochloride (PubChem CID 22640107) has the molecular formula C30H34ClF3N4O and a molecular weight of 559.08 g/mol. Its IUPAC name is 9-[4-[4-(4-aminophenyl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;hydrochloride.
| Compound Name | 9-[4-[4-(4-aminophenyl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 22640107 |
| Molecular Formula | C30H34ClF3N4O |
| Molecular Weight | 559.08 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 9-[4-[4-(4-aminophenyl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccc(N2CCN(CCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C30H33F3N4O.ClH/c31-30(32,33)21-35-28(38)29(26-9-3-1-7-24(26)25-8-2-4-10-27(25)29)15-5-6-16-36-17-19-37(20-18-36)23-13-11-22(34)12-14-23;/h1-4,7-14H,5-6,15-21,34H2,(H,35,38);1H |
| InChIKey | VVYYUZPOUYRSJB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.08 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|