C35H35F3N4O — CID 22640193
9-[4-[4-(6-phenyl-2-pyridinyl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22640193) has the molecular formula C35H35F3N4O and a molecular weight of 584.69 g/mol. Its IUPAC name is 9-[4-[4-(6-phenyl-2-pyridinyl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-(6-phenyl-2-pyridinyl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22640193 |
| Molecular Formula | C35H35F3N4O |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | 9-[4-[4-(6-phenyl-2-pyridinyl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCN2CCN(c3cccc(-c4ccccc4)n3)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H35F3N4O/c36-35(37,38)25-39-33(43)34(29-15-6-4-13-27(29)28-14-5-7-16-30(28)34)19-8-9-20-41-21-23-42(24-22-41)32-18-10-17-31(40-32)26-11-2-1-3-12-26/h1-7,10-18H,8-9,19-25H2,(H,39,43) |
| InChIKey | BRCNUYDGCMTBAH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|