C35H37FN4O2 — CID 22640125
N-[(4-fluorophenyl)methyl]-9-[4-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]butyl]fluorene-9-carboxamide (PubChem CID 22640125) has the molecular formula C35H37FN4O2 and a molecular weight of 564.71 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-9-[4-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]butyl]fluorene-9-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-9-[4-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]butyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22640125 |
| Molecular Formula | C35H37FN4O2 |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-9-[4-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]butyl]fluorene-9-carboxamide |
| SMILES | COc1cccc(N2CCN(CCCCC3(C(=O)NCc4ccc(F)cc4)c4ccccc4-c4ccccc43)CC2)n1 |
| InChI | InChI=1S/C35H37FN4O2/c1-42-33-14-8-13-32(38-33)40-23-21-39(22-24-40)20-7-6-19-35(34(41)37-25-26-15-17-27(36)18-16-26)30-11-4-2-9-28(30)29-10-3-5-12-31(29)35/h2-5,8-18H,6-7,19-25H2,1H3,(H,37,41) |
| InChIKey | YESRUXVVMGOHAC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|