C39H41FN4O2 — CID 22180579
N-ethyl-9-[4-[4-[2-[(3-fluorophenyl)methyl]-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]butyl]fluorene-9-carboxamide (PubChem CID 22180579) has the molecular formula C39H41FN4O2 and a molecular weight of 616.78 g/mol. Its IUPAC name is N-ethyl-9-[4-[4-[2-[(3-fluorophenyl)methyl]-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]butyl]fluorene-9-carboxamide.
| Compound Name | N-ethyl-9-[4-[4-[2-[(3-fluorophenyl)methyl]-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]butyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22180579 |
| Molecular Formula | C39H41FN4O2 |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | N-ethyl-9-[4-[4-[2-[(3-fluorophenyl)methyl]-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]butyl]fluorene-9-carboxamide |
| SMILES | CCNC(=O)C1(CCCCN2CCN(c3ccc4c(c3)C(=O)N(Cc3cccc(F)c3)C4)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H41FN4O2/c1-2-41-38(46)39(35-14-5-3-12-32(35)33-13-4-6-15-36(33)39)18-7-8-19-42-20-22-43(23-21-42)31-17-16-29-27-44(37(45)34(29)25-31)26-28-10-9-11-30(40)24-28/h3-6,9-17,24-25H,2,7-8,18-23,26-27H2,1H3,(H,41,46) |
| InChIKey | VTAIJTZYMRZSKT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|