C37H44N4O3S — CID 22180398
N-ethyl-9-[3-[4-[2-(oxan-2-ylmethyl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]propyl]thioxanthene-9-carboxamide (PubChem CID 22180398) has the molecular formula C37H44N4O3S and a molecular weight of 624.85 g/mol. Its IUPAC name is N-ethyl-9-[3-[4-[2-(oxan-2-ylmethyl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]propyl]thioxanthene-9-carboxamide.
| Compound Name | N-ethyl-9-[3-[4-[2-(oxan-2-ylmethyl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]propyl]thioxanthene-9-carboxamide |
|---|---|
| PubChem CID | 22180398 |
| Molecular Formula | C37H44N4O3S |
| Molecular Weight | 624.85 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | N-ethyl-9-[3-[4-[2-(oxan-2-ylmethyl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]propyl]thioxanthene-9-carboxamide |
| SMILES | CCNC(=O)C1(CCCN2CCN(c3ccc4c(c3)C(=O)N(CC3CCCCO3)C4)CC2)c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C37H44N4O3S/c1-2-38-36(43)37(31-11-3-5-13-33(31)45-34-14-6-4-12-32(34)37)17-9-18-39-19-21-40(22-20-39)28-16-15-27-25-41(35(42)30(27)24-28)26-29-10-7-8-23-44-29/h3-6,11-16,24,29H,2,7-10,17-23,25-26H2,1H3,(H,38,43) |
| InChIKey | VUJIPOIMLVXYIU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.85 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|