C40H44N4O2S — CID 22180592
9-[4-[4-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-7-yl)piperazin-1-yl]butyl]-N-ethylthioxanthene-9-carboxamide (PubChem CID 22180592) has the molecular formula C40H44N4O2S and a molecular weight of 644.89 g/mol. Its IUPAC name is 9-[4-[4-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-7-yl)piperazin-1-yl]butyl]-N-ethylthioxanthene-9-carboxamide.
| Compound Name | 9-[4-[4-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-7-yl)piperazin-1-yl]butyl]-N-ethylthioxanthene-9-carboxamide |
|---|---|
| PubChem CID | 22180592 |
| Molecular Formula | C40H44N4O2S |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | 9-[4-[4-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-7-yl)piperazin-1-yl]butyl]-N-ethylthioxanthene-9-carboxamide |
| SMILES | CCNC(=O)C1(CCCCN2CCN(c3ccc4c(c3)C(=O)N(Cc3ccccc3)CC4)CC2)c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C40H44N4O2S/c1-2-41-39(46)40(34-14-6-8-16-36(34)47-37-17-9-7-15-35(37)40)21-10-11-22-42-24-26-43(27-25-42)32-19-18-31-20-23-44(38(45)33(31)28-32)29-30-12-4-3-5-13-30/h3-9,12-19,28H,2,10-11,20-27,29H2,1H3,(H,41,46) |
| InChIKey | NOQPLESIRMZLJT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|