C33H34F3N5O — CID 22636289
9-[4-(4-quinazolin-2-yl-1,4-diazepan-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22636289) has the molecular formula C33H34F3N5O and a molecular weight of 573.66 g/mol. Its IUPAC name is 9-[4-(4-quinazolin-2-yl-1,4-diazepan-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-(4-quinazolin-2-yl-1,4-diazepan-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22636289 |
| Molecular Formula | C33H34F3N5O |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | 9-[4-(4-quinazolin-2-yl-1,4-diazepan-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCN2CCCN(c3ncc4ccccc4n3)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H34F3N5O/c34-33(35,36)23-38-30(42)32(27-13-4-2-11-25(27)26-12-3-5-14-28(26)32)16-7-8-17-40-18-9-19-41(21-20-40)31-37-22-24-10-1-6-15-29(24)39-31/h1-6,10-15,22H,7-9,16-21,23H2,(H,38,42) |
| InChIKey | BKXUQZUANRQCSK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|