C32H32F3N5OS — CID 22640149
9-[4-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22640149) has the molecular formula C32H32F3N5OS and a molecular weight of 591.70 g/mol. Its IUPAC name is 9-[4-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22640149 |
| Molecular Formula | C32H32F3N5OS |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 9-[4-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCN2CCN(c3nc(-c4ccccc4)ns3)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H32F3N5OS/c33-32(34,35)22-36-29(41)31(26-14-6-4-12-24(26)25-13-5-7-15-27(25)31)16-8-9-17-39-18-20-40(21-19-39)30-37-28(38-42-30)23-10-2-1-3-11-23/h1-7,10-15H,8-9,16-22H2,(H,36,41) |
| InChIKey | OPLUFNROQJFTRT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|