C14H18N4OS — CID 102284424
2-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanol (PubChem CID 102284424) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 102284424 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(c2nc(-c3ccccc3)ns2)CC1 |
| InChI | InChI=1S/C14H18N4OS/c19-11-10-17-6-8-18(9-7-17)14-15-13(16-20-14)12-4-2-1-3-5-12/h1-5,19H,6-11H2 |
| InChIKey | YJJUMKHAMGAZHL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |