C14H19N5O2S2 — CID 133484684
2-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanesulfonamide (PubChem CID 133484684) has the molecular formula C14H19N5O2S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanesulfonamide.
| Compound Name | 2-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 133484684 |
| Molecular Formula | C14H19N5O2S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCN1CCN(c2nc(-c3ccccc3)ns2)CC1 |
| InChI | InChI=1S/C14H19N5O2S2/c15-23(20,21)11-10-18-6-8-19(9-7-18)14-16-13(17-22-14)12-4-2-1-3-5-12/h1-5H,6-11H2,(H2,15,20,21) |
| InChIKey | SEZXRVZNVAQZKU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |