C28H24F3N3O2S — CID 22891222
9-[4-[(3-phenyl-1,2,4-oxadiazol-5-yl)sulfanyl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22891222) has the molecular formula C28H24F3N3O2S and a molecular weight of 523.58 g/mol. Its IUPAC name is 9-[4-[(3-phenyl-1,2,4-oxadiazol-5-yl)sulfanyl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[(3-phenyl-1,2,4-oxadiazol-5-yl)sulfanyl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891222 |
| Molecular Formula | C28H24F3N3O2S |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 9-[4-[(3-phenyl-1,2,4-oxadiazol-5-yl)sulfanyl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCSc2nc(-c3ccccc3)no2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H24F3N3O2S/c29-28(30,31)18-32-25(35)27(22-14-6-4-12-20(22)21-13-5-7-15-23(21)27)16-8-9-17-37-26-33-24(34-36-26)19-10-2-1-3-11-19/h1-7,10-15H,8-9,16-18H2,(H,32,35) |
| InChIKey | XNHXRKSWSWHDEL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|