About 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide
9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide (PubChem CID 22180397) has the molecular formula C20H19BrF3NOS
and a molecular weight of 458.34 g/mol. Its IUPAC name is 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide.
Molecular Properties
| Compound Name | 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide |
| PubChem CID | 22180397 |
| Molecular Formula | C20H19BrF3NOS |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCBr)c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C20H19BrF3NOS/c21-12-6-5-11-19(18(26)25-13-20(22,23)24)14-7-1-3-9-16(14)27-17-10-4-2-8-15(17)19/h1-4,7-10H,5-6,11-13H2,(H,25,26) |
| InChIKey | KMMVCKMZXGEAPP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide?
The IUPAC name of 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide (CID 22180397) is 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide.
What is the SMILES notation for 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide?
The canonical SMILES for 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide is O=C(NCC(F)(F)F)C1(CCCCBr)c2ccccc2Sc2ccccc21.
What is the InChIKey of 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide?
The InChIKey is KMMVCKMZXGEAPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19BrF3NOS/c21-12-6-5-11-19(18(26)25-13-20(22,23)24)14-7-1-3-9-16(14)27-17-10-4-2-8-15(17)19/h1-4,7-10H,5-6,11-13H2,(H,25,26).
What are the key properties of 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide?
9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide has a molecular weight of 458.34 g/mol, XLogP of 5.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-bromobutyl)-N-(2,2,2-trifluoroethyl)thioxanthene-9-carboxamide is sourced from PubChem (CID 22180397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).